C28H46O9 — CID 155203678
[6-[[2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]methoxycarbonyloxy]-6-methyl-4-methylideneoctyl] 2-methylprop-2-enoate (PubChem CID 155203678) has the molecular formula C28H46O9 and a molecular weight of 526.67 g/mol. Its IUPAC name is [6-[[2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]methoxycarbonyloxy]-6-methyl-4-methylideneoctyl] 2-methylprop-2-enoate.
| Compound Name | [6-[[2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]methoxycarbonyloxy]-6-methyl-4-methylideneoctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155203678 |
| Molecular Formula | C28H46O9 |
| Molecular Weight | 526.67 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | [6-[[2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]methoxycarbonyloxy]-6-methyl-4-methylideneoctyl] 2-methylprop-2-enoate |
| SMILES | C=C(CCCOC(=O)C(=C)C)CC(C)(CC)OC(=O)OCC1CC(CC(=O)OC(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C28H46O9/c1-11-28(10,17-20(4)13-12-14-32-24(30)19(2)3)37-25(31)33-18-22-15-21(34-27(8,9)35-22)16-23(29)36-26(5,6)7/h21-22H,2,4,11-18H2,1,3,5-10H3 |
| InChIKey | ZRPSCCASOUNNHQ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|