C6H11N3 — CID 15520387
3,5-diethyl-1H-1,2,4-triazole (PubChem CID 15520387) has the molecular formula C6H11N3 and a molecular weight of 125.17 g/mol. Its IUPAC name is 3,5-diethyl-1H-1,2,4-triazole.
| Compound Name | 3,5-diethyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 15520387 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 3,5-diethyl-1H-1,2,4-triazole |
| SMILES | CCc1n[nH]c(CC)n1 |
| InChI | InChI=1S/C6H11N3/c1-3-5-7-6(4-2)9-8-5/h3-4H2,1-2H3,(H,7,8,9) |
| InChIKey | UGERGYDWQOPISO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |