C21H26Cl2N4O2 — CID 155204015
6-[(3aR,6aS)-3a-(aminomethyl)-5-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-one (PubChem CID 155204015) has the molecular formula C21H26Cl2N4O2 and a molecular weight of 437.37 g/mol. Its IUPAC name is 6-[(3aR,6aS)-3a-(aminomethyl)-5-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-one.
| Compound Name | 6-[(3aR,6aS)-3a-(aminomethyl)-5-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 155204015 |
| Molecular Formula | C21H26Cl2N4O2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 6-[(3aR,6aS)-3a-(aminomethyl)-5-(hydroxymethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-3-(2,3-dichlorophenyl)-2,5-dimethylpyrimidin-4-one |
| SMILES | Cc1c(N2C[C@H]3CC(CO)C[C@@]3(CN)C2)nc(C)n(-c2cccc(Cl)c2Cl)c1=O |
| InChI | InChI=1S/C21H26Cl2N4O2/c1-12-19(26-8-15-6-14(9-28)7-21(15,10-24)11-26)25-13(2)27(20(12)29)17-5-3-4-16(22)18(17)23/h3-5,14-15,28H,6-11,24H2,1-2H3/t14?,15-,21-/m1/s1 |
| InChIKey | VKYSHDUUABYIFO-MYJGDOQTSA-N |
| XLogP | 2.94 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |