C35H38N6O3 — CID 155204157
2-[[2-[3-(1H-indol-3-yl)propanoylamino]-3-phenylpropanoyl]amino]-6-(quinolin-2-ylamino)hexanamide (PubChem CID 155204157) has the molecular formula C35H38N6O3 and a molecular weight of 590.73 g/mol. Its IUPAC name is 2-[[2-[3-(1H-indol-3-yl)propanoylamino]-3-phenylpropanoyl]amino]-6-(quinolin-2-ylamino)hexanamide.
| Compound Name | 2-[[2-[3-(1H-indol-3-yl)propanoylamino]-3-phenylpropanoyl]amino]-6-(quinolin-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 155204157 |
| Molecular Formula | C35H38N6O3 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 2-[[2-[3-(1H-indol-3-yl)propanoylamino]-3-phenylpropanoyl]amino]-6-(quinolin-2-ylamino)hexanamide |
| SMILES | NC(=O)C(CCCCNc1ccc2ccccc2n1)NC(=O)C(Cc1ccccc1)NC(=O)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C35H38N6O3/c36-34(43)30(16-8-9-21-37-32-19-17-25-12-4-6-14-28(25)39-32)41-35(44)31(22-24-10-2-1-3-11-24)40-33(42)20-18-26-23-38-29-15-7-5-13-27(26)29/h1-7,10-15,17,19,23,30-31,38H,8-9,16,18,20-22H2,(H2,36,43)(H,37,39)(H,40,42)(H,41,44) |
| InChIKey | JANGENZLYZLILL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|