C10H13NO — CID 155204466
6,6-dimethyl-2,3-dihydrofuro[2,3-b]azepine (PubChem CID 155204466) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 6,6-dimethyl-2,3-dihydrofuro[2,3-b]azepine.
| Compound Name | 6,6-dimethyl-2,3-dihydrofuro[2,3-b]azepine |
|---|---|
| PubChem CID | 155204466 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 6,6-dimethyl-2,3-dihydrofuro[2,3-b]azepine |
| SMILES | CC1(C)C=CC2=C(N=C1)OCC2 |
| InChI | InChI=1S/C10H13NO/c1-10(2)5-3-8-4-6-12-9(8)11-7-10/h3,5,7H,4,6H2,1-2H3 |
| InChIKey | IPHGTJXTGMFEMC-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |