About 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate
2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate (PubChem CID 155204470) has the molecular formula C20H19F6NO5S
and a molecular weight of 499.43 g/mol. Its IUPAC name is 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate |
| PubChem CID | 155204470 |
| Molecular Formula | C20H19F6NO5S |
| Molecular Weight | 499.43 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate |
| SMILES | CC(C)COC(=O)CN=S(=O)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H19F6NO5S/c1-13(2)12-30-18(28)11-27-33(29,16-7-3-5-14(9-16)31-19(21,22)23)17-8-4-6-15(10-17)32-20(24,25)26/h3-10,13H,11-12H2,1-2H3 |
| InChIKey | SAQSTMNPJARNPF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate?
The IUPAC name of 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate (CID 155204470) is 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate.
What is the SMILES notation for 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate?
The canonical SMILES for 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate is CC(C)COC(=O)CN=S(=O)(c1cccc(OC(F)(F)F)c1)c1cccc(OC(F)(F)F)c1.
What is the InChIKey of 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate?
The InChIKey is SAQSTMNPJARNPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F6NO5S/c1-13(2)12-30-18(28)11-27-33(29,16-7-3-5-14(9-16)31-19(21,22)23)17-8-4-6-15(10-17)32-20(24,25)26/h3-10,13H,11-12H2,1-2H3.
What are the key properties of 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate?
2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate has a molecular weight of 499.43 g/mol, XLogP of 5.57, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-[[oxo-bis[3-(trifluoromethoxy)phenyl]-λ6-sulfanylidene]amino]acetate is sourced from PubChem (CID 155204470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).