C19H24O2 — CID 155205002
8-(2-cyclohexa-1,5-dien-1-ylethyl)-3-methyl-5,7,8,9-tetrahydro-2H-1-benzoxepin-6-one (PubChem CID 155205002) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 8-(2-cyclohexa-1,5-dien-1-ylethyl)-3-methyl-5,7,8,9-tetrahydro-2H-1-benzoxepin-6-one.
| Compound Name | 8-(2-cyclohexa-1,5-dien-1-ylethyl)-3-methyl-5,7,8,9-tetrahydro-2H-1-benzoxepin-6-one |
|---|---|
| PubChem CID | 155205002 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 8-(2-cyclohexa-1,5-dien-1-ylethyl)-3-methyl-5,7,8,9-tetrahydro-2H-1-benzoxepin-6-one |
| SMILES | CC1=CCC2=C(CC(CCC3=CCCC=C3)CC2=O)OC1 |
| InChI | InChI=1S/C19H24O2/c1-14-7-10-17-18(20)11-16(12-19(17)21-13-14)9-8-15-5-3-2-4-6-15/h3,5-7,16H,2,4,8-13H2,1H3 |
| InChIKey | FFIQZOGYXIDNDG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|