About 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal
3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal (PubChem CID 155205020) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal.
Molecular Properties
| Compound Name | 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal |
| PubChem CID | 155205020 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal |
| SMILES | O=CCC[C@@H]1NCOC1=O |
| InChI | InChI=1S/C6H9NO3/c8-3-1-2-5-6(9)10-4-7-5/h3,5,7H,1-2,4H2/t5-/m0/s1 |
| InChIKey | SFYCYGCCKJQPOY-YFKPBYRVSA-N |
| XLogP | -0.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal?
The IUPAC name of 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal (CID 155205020) is 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal.
What is the SMILES notation for 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal?
The canonical SMILES for 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal is O=CCC[C@@H]1NCOC1=O.
What is the InChIKey of 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal?
The InChIKey is SFYCYGCCKJQPOY-YFKPBYRVSA-N. The full InChI is InChI=1S/C6H9NO3/c8-3-1-2-5-6(9)10-4-7-5/h3,5,7H,1-2,4H2/t5-/m0/s1.
What are the key properties of 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal?
3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal has a molecular weight of 143.14 g/mol, XLogP of -0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4S)-5-oxo-1,3-oxazolidin-4-yl]propanal is sourced from PubChem (CID 155205020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).