About (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine
(2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine (PubChem CID 155205815) has the molecular formula C10H12IN
and a molecular weight of 273.12 g/mol. Its IUPAC name is (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine.
Molecular Properties
| Compound Name | (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine |
| PubChem CID | 155205815 |
| Molecular Formula | C10H12IN |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine |
| SMILES | CN[C@H]1Cc2ccc(I)cc2C1 |
| InChI | InChI=1S/C10H12IN/c1-12-10-5-7-2-3-9(11)4-8(7)6-10/h2-4,10,12H,5-6H2,1H3/t10-/m0/s1 |
| InChIKey | SHFFYRAZFRYCLQ-JTQLQIEISA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine?
The IUPAC name of (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine (CID 155205815) is (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine.
What is the SMILES notation for (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine?
The canonical SMILES for (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine is CN[C@H]1Cc2ccc(I)cc2C1.
What is the InChIKey of (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine?
The InChIKey is SHFFYRAZFRYCLQ-JTQLQIEISA-N. The full InChI is InChI=1S/C10H12IN/c1-12-10-5-7-2-3-9(11)4-8(7)6-10/h2-4,10,12H,5-6H2,1H3/t10-/m0/s1.
What are the key properties of (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine?
(2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine has a molecular weight of 273.12 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-iodo-N-methyl-2,3-dihydro-1H-inden-2-amine is sourced from PubChem (CID 155205815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).