C24H24N6O3 — CID 155206353
1-[4-[7-(dimethylamino)quinazolin-4-yl]oxyphenyl]-3-[(6-methoxy-3-pyridinyl)methyl]urea (PubChem CID 155206353) has the molecular formula C24H24N6O3 and a molecular weight of 444.50 g/mol. Its IUPAC name is 1-[4-[7-(dimethylamino)quinazolin-4-yl]oxyphenyl]-3-[(6-methoxy-3-pyridinyl)methyl]urea.
| Compound Name | 1-[4-[7-(dimethylamino)quinazolin-4-yl]oxyphenyl]-3-[(6-methoxy-3-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 155206353 |
| Molecular Formula | C24H24N6O3 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-[4-[7-(dimethylamino)quinazolin-4-yl]oxyphenyl]-3-[(6-methoxy-3-pyridinyl)methyl]urea |
| SMILES | COc1ccc(CNC(=O)Nc2ccc(Oc3ncnc4cc(N(C)C)ccc34)cc2)cn1 |
| InChI | InChI=1S/C24H24N6O3/c1-30(2)18-7-10-20-21(12-18)27-15-28-23(20)33-19-8-5-17(6-9-19)29-24(31)26-14-16-4-11-22(32-3)25-13-16/h4-13,15H,14H2,1-3H3,(H2,26,29,31) |
| InChIKey | BQRHGQMIXCBRQP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |