C7H3N5O2 — CID 155206933
4-oxa-3,5,8,10,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,5,9,11-pentaen-7-one (PubChem CID 155206933) has the molecular formula C7H3N5O2 and a molecular weight of 189.13 g/mol. Its IUPAC name is 4-oxa-3,5,8,10,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,5,9,11-pentaen-7-one.
| Compound Name | 4-oxa-3,5,8,10,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,5,9,11-pentaen-7-one |
|---|---|
| PubChem CID | 155206933 |
| Molecular Formula | C7H3N5O2 |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | 4-oxa-3,5,8,10,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,5,9,11-pentaen-7-one |
| SMILES | O=c1[nH]c2nccnc2c2nonc12 |
| InChI | InChI=1S/C7H3N5O2/c13-7-5-3(11-14-12-5)4-6(10-7)9-2-1-8-4/h1-2H,(H,9,10,13) |
| InChIKey | WXTKVKAEKKSQKY-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |