C19H23N7OS — CID 155207149
1-(2-cyclopropyl-1,3-thiazol-4-yl)-6-[2-(2-methylidenebut-3-enyl)hydrazinyl]-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 155207149) has the molecular formula C19H23N7OS and a molecular weight of 397.51 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-thiazol-4-yl)-6-[2-(2-methylidenebut-3-enyl)hydrazinyl]-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(2-cyclopropyl-1,3-thiazol-4-yl)-6-[2-(2-methylidenebut-3-enyl)hydrazinyl]-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 155207149 |
| Molecular Formula | C19H23N7OS |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-thiazol-4-yl)-6-[2-(2-methylidenebut-3-enyl)hydrazinyl]-2-propan-2-ylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CC(=C)CNNc1ncc2c(=O)n(C(C)C)n(-c3csc(C4CC4)n3)c2n1 |
| InChI | InChI=1S/C19H23N7OS/c1-5-12(4)8-21-24-19-20-9-14-16(23-19)26(25(11(2)3)18(14)27)15-10-28-17(22-15)13-6-7-13/h5,9-11,13,21H,1,4,6-8H2,2-3H3,(H,20,23,24) |
| InChIKey | JPERETWGDQNYRZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|