C17H31NO — CID 155207170
(2R,4S)-4-ethenyl-4,6,7-trimethyl-2-[(2R)-pyrrolidin-2-yl]octan-3-one (PubChem CID 155207170) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is (2R,4S)-4-ethenyl-4,6,7-trimethyl-2-[(2R)-pyrrolidin-2-yl]octan-3-one.
| Compound Name | (2R,4S)-4-ethenyl-4,6,7-trimethyl-2-[(2R)-pyrrolidin-2-yl]octan-3-one |
|---|---|
| PubChem CID | 155207170 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | (2R,4S)-4-ethenyl-4,6,7-trimethyl-2-[(2R)-pyrrolidin-2-yl]octan-3-one |
| SMILES | C=C[C@](C)(CC(C)C(C)C)C(=O)[C@H](C)[C@H]1CCCN1 |
| InChI | InChI=1S/C17H31NO/c1-7-17(6,11-13(4)12(2)3)16(19)14(5)15-9-8-10-18-15/h7,12-15,18H,1,8-11H2,2-6H3/t13?,14-,15-,17-/m1/s1 |
| InChIKey | XPVANIBHGTZPPM-HYGDKIEISA-N |
| XLogP | 3.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|