C7H15F2NO4P2 — CID 155207384
4-[fluoro-[[fluoro(propoxy)phosphoryl]amino]phosphoryl]oxybut-1-ene (PubChem CID 155207384) has the molecular formula C7H15F2NO4P2 and a molecular weight of 277.14 g/mol. Its IUPAC name is 4-[fluoro-[[fluoro(propoxy)phosphoryl]amino]phosphoryl]oxybut-1-ene.
| Compound Name | 4-[fluoro-[[fluoro(propoxy)phosphoryl]amino]phosphoryl]oxybut-1-ene |
|---|---|
| PubChem CID | 155207384 |
| Molecular Formula | C7H15F2NO4P2 |
| Molecular Weight | 277.14 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 4-[fluoro-[[fluoro(propoxy)phosphoryl]amino]phosphoryl]oxybut-1-ene |
| SMILES | C=CCCOP(=O)(F)NP(=O)(F)OCCC |
| InChI | InChI=1S/C7H15F2NO4P2/c1-3-5-7-14-16(9,12)10-15(8,11)13-6-4-2/h3H,1,4-7H2,2H3,(H,10,11,12) |
| InChIKey | PMHBJGYSWFEMAT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.14 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|