C45H37N3 — CID 155207418
N-(9,9-dimethylfluoren-2-yl)-N-[4-[9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]carbazol-3-yl]phenyl]pyridin-2-amine (PubChem CID 155207418) has the molecular formula C45H37N3 and a molecular weight of 619.81 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-N-[4-[9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]carbazol-3-yl]phenyl]pyridin-2-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-N-[4-[9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]carbazol-3-yl]phenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 155207418 |
| Molecular Formula | C45H37N3 |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-N-[4-[9-[(2E,4Z)-hepta-2,4,6-trien-3-yl]carbazol-3-yl]phenyl]pyridin-2-amine |
| SMILES | C=C/C=C\C(=C/C)n1c2ccccc2c2cc(-c3ccc(N(c4ccc5c(c4)C(C)(C)c4ccccc4-5)c4ccccn4)cc3)ccc21 |
| InChI | InChI=1S/C45H37N3/c1-5-7-14-33(6-2)48-42-18-11-9-16-38(42)39-29-32(22-27-43(39)48)31-20-23-34(24-21-31)47(44-19-12-13-28-46-44)35-25-26-37-36-15-8-10-17-40(36)45(3,4)41(37)30-35/h5-30H,1H2,2-4H3/b14-7-,33-6+ |
| InChIKey | SPLMSZFVDXDNQK-WHNOEDTHSA-N |
| XLogP | 12.24 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|