C17H28ClN3O — CID 155207531
2-chloro-2-methyl-1-[4-methyl-4-[4-(2-methylpropyl)pyrazol-1-yl]piperidin-1-yl]propan-1-one (PubChem CID 155207531) has the molecular formula C17H28ClN3O and a molecular weight of 325.88 g/mol. Its IUPAC name is 2-chloro-2-methyl-1-[4-methyl-4-[4-(2-methylpropyl)pyrazol-1-yl]piperidin-1-yl]propan-1-one.
| Compound Name | 2-chloro-2-methyl-1-[4-methyl-4-[4-(2-methylpropyl)pyrazol-1-yl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 155207531 |
| Molecular Formula | C17H28ClN3O |
| Molecular Weight | 325.88 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-chloro-2-methyl-1-[4-methyl-4-[4-(2-methylpropyl)pyrazol-1-yl]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)Cc1cnn(C2(C)CCN(C(=O)C(C)(C)Cl)CC2)c1 |
| InChI | InChI=1S/C17H28ClN3O/c1-13(2)10-14-11-19-21(12-14)17(5)6-8-20(9-7-17)15(22)16(3,4)18/h11-13H,6-10H2,1-5H3 |
| InChIKey | BYYPIZSXJHCRFT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.88 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|