About [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate
[1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate (PubChem CID 155207617) has the molecular formula C10H15F3O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate.
Molecular Properties
| Compound Name | [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate |
| PubChem CID | 155207617 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1(C(F)(F)F)CCCC1 |
| InChI | InChI=1S/C10H15F3O2/c1-7(2)8(14)15-9(10(11,12)13)5-3-4-6-9/h7H,3-6H2,1-2H3 |
| InChIKey | MHTFZSYWYQBZBL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate?
The IUPAC name of [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate (CID 155207617) is [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate.
What is the SMILES notation for [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate?
The canonical SMILES for [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate is CC(C)C(=O)OC1(C(F)(F)F)CCCC1.
What is the InChIKey of [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate?
The InChIKey is MHTFZSYWYQBZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O2/c1-7(2)8(14)15-9(10(11,12)13)5-3-4-6-9/h7H,3-6H2,1-2H3.
What are the key properties of [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate?
[1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate has a molecular weight of 224.22 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(trifluoromethyl)cyclopentyl] 2-methylpropanoate is sourced from PubChem (CID 155207617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).