About 3-propoxypropyl N,N-dimethylcarbamate
3-propoxypropyl N,N-dimethylcarbamate (PubChem CID 15520778) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is 3-propoxypropyl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | 3-propoxypropyl N,N-dimethylcarbamate |
| PubChem CID | 15520778 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 3-propoxypropyl N,N-dimethylcarbamate |
| SMILES | CCCOCCCOC(=O)N(C)C |
| InChI | InChI=1S/C9H19NO3/c1-4-6-12-7-5-8-13-9(11)10(2)3/h4-8H2,1-3H3 |
| InChIKey | MEALMIVFRNHASE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-propoxypropyl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propoxypropyl N,N-dimethylcarbamate?
The IUPAC name of 3-propoxypropyl N,N-dimethylcarbamate (CID 15520778) is 3-propoxypropyl N,N-dimethylcarbamate.
What is the SMILES notation for 3-propoxypropyl N,N-dimethylcarbamate?
The canonical SMILES for 3-propoxypropyl N,N-dimethylcarbamate is CCCOCCCOC(=O)N(C)C.
What is the InChIKey of 3-propoxypropyl N,N-dimethylcarbamate?
The InChIKey is MEALMIVFRNHASE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-4-6-12-7-5-8-13-9(11)10(2)3/h4-8H2,1-3H3.
What are the key properties of 3-propoxypropyl N,N-dimethylcarbamate?
3-propoxypropyl N,N-dimethylcarbamate has a molecular weight of 189.25 g/mol, XLogP of 1.50, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propoxypropyl N,N-dimethylcarbamate is sourced from PubChem (CID 15520778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).