C24H27N5O3 — CID 155208122
tert-butyl 4-[4-[(3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-9-yl)methyl]pyrazol-1-yl]piperidine-1-carboxylate (PubChem CID 155208122) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is tert-butyl 4-[4-[(3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-9-yl)methyl]pyrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[(3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-9-yl)methyl]pyrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155208122 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | tert-butyl 4-[4-[(3-oxo-2,10-diazatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-9-yl)methyl]pyrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(n2cc(Cc3ncc4c5c(cccc35)C(=O)N4)cn2)CC1 |
| InChI | InChI=1S/C24H27N5O3/c1-24(2,3)32-23(31)28-9-7-16(8-10-28)29-14-15(12-26-29)11-19-17-5-4-6-18-21(17)20(13-25-19)27-22(18)30/h4-6,12-14,16H,7-11H2,1-3H3,(H,27,30) |
| InChIKey | ILEBGBHBFRSUBR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |