About methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate
methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate (PubChem CID 15520854) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate.
Molecular Properties
| Compound Name | methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate |
| PubChem CID | 15520854 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate |
| SMILES | C=C(C(=O)OC)C(O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C14H22O3/c1-10(2)7-6-8-11(3)9-13(15)12(4)14(16)17-5/h7,9,13,15H,4,6,8H2,1-3,5H3/b11-9+ |
| InChIKey | YANDEWUSSLSRJT-PKNBQFBNSA-N |
| XLogP | 2.77 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate?
The IUPAC name of methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate (CID 15520854) is methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate.
What is the SMILES notation for methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate?
The canonical SMILES for methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate is C=C(C(=O)OC)C(O)/C=C(\C)CCC=C(C)C.
What is the InChIKey of methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate?
The InChIKey is YANDEWUSSLSRJT-PKNBQFBNSA-N. The full InChI is InChI=1S/C14H22O3/c1-10(2)7-6-8-11(3)9-13(15)12(4)14(16)17-5/h7,9,13,15H,4,6,8H2,1-3,5H3/b11-9+.
What are the key properties of methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate?
methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate has a molecular weight of 238.33 g/mol, XLogP of 2.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienoate is sourced from PubChem (CID 15520854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).