About (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile
(4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile (PubChem CID 15520855) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile.
Molecular Properties
| Compound Name | (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile |
| PubChem CID | 15520855 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile |
| SMILES | C=C(C#N)C(O)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H19NO/c1-10(2)6-5-7-11(3)8-13(15)12(4)9-14/h6,8,13,15H,4-5,7H2,1-3H3/b11-8+ |
| InChIKey | MPDVVODGSUWOKK-DHZHZOJOSA-N |
| XLogP | 3.12 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile?
The IUPAC name of (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile (CID 15520855) is (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile.
What is the SMILES notation for (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile?
The canonical SMILES for (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile is C=C(C#N)C(O)/C=C(\C)CCC=C(C)C.
What is the InChIKey of (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile?
The InChIKey is MPDVVODGSUWOKK-DHZHZOJOSA-N. The full InChI is InChI=1S/C13H19NO/c1-10(2)6-5-7-11(3)8-13(15)12(4)9-14/h6,8,13,15H,4-5,7H2,1-3H3/b11-8+.
What are the key properties of (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile?
(4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile has a molecular weight of 205.30 g/mol, XLogP of 3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-3-hydroxy-5,9-dimethyl-2-methylidenedeca-4,8-dienenitrile is sourced from PubChem (CID 15520855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).