About (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine
(3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine (PubChem CID 155208566) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine.
Molecular Properties
| Compound Name | (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine |
| PubChem CID | 155208566 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine |
| SMILES | C/C=C(\CCN(C)C(C)C)CC(C)(C)C |
| InChI | InChI=1S/C14H29N/c1-8-13(11-14(4,5)6)9-10-15(7)12(2)3/h8,12H,9-11H2,1-7H3/b13-8+ |
| InChIKey | AHEPQTXWYATKDD-MDWZMJQESA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine?
The IUPAC name of (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine (CID 155208566) is (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine.
What is the SMILES notation for (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine?
The canonical SMILES for (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine is C/C=C(\CCN(C)C(C)C)CC(C)(C)C.
What is the InChIKey of (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine?
The InChIKey is AHEPQTXWYATKDD-MDWZMJQESA-N. The full InChI is InChI=1S/C14H29N/c1-8-13(11-14(4,5)6)9-10-15(7)12(2)3/h8,12H,9-11H2,1-7H3/b13-8+.
What are the key properties of (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine?
(3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine has a molecular weight of 211.39 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethylidene-N,5,5-trimethyl-N-propan-2-ylhexan-1-amine is sourced from PubChem (CID 155208566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).