C15H25NO2S — CID 155208585
N,N-dimethyl-5-propan-2-ylsulfonyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-amine (PubChem CID 155208585) has the molecular formula C15H25NO2S and a molecular weight of 283.44 g/mol. Its IUPAC name is N,N-dimethyl-5-propan-2-ylsulfonyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-amine.
| Compound Name | N,N-dimethyl-5-propan-2-ylsulfonyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 155208585 |
| Molecular Formula | C15H25NO2S |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | N,N-dimethyl-5-propan-2-ylsulfonyl-1,2,4a,7,8,8a-hexahydronaphthalen-1-amine |
| SMILES | CC(C)S(=O)(=O)C1=CCCC2C1C=CCC2N(C)C |
| InChI | InChI=1S/C15H25NO2S/c1-11(2)19(17,18)15-10-6-7-12-13(15)8-5-9-14(12)16(3)4/h5,8,10-14H,6-7,9H2,1-4H3 |
| InChIKey | YYOOPKCVLHYJDU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|