C25H20ClFN6O — CID 155208725
8-chloro-6-fluoro-7-(5-methyl-1H-indazol-4-yl)-4-(4-prop-2-enoylpiperazin-1-yl)quinoline-3-carbonitrile (PubChem CID 155208725) has the molecular formula C25H20ClFN6O and a molecular weight of 474.93 g/mol. Its IUPAC name is 8-chloro-6-fluoro-7-(5-methyl-1H-indazol-4-yl)-4-(4-prop-2-enoylpiperazin-1-yl)quinoline-3-carbonitrile.
| Compound Name | 8-chloro-6-fluoro-7-(5-methyl-1H-indazol-4-yl)-4-(4-prop-2-enoylpiperazin-1-yl)quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 155208725 |
| Molecular Formula | C25H20ClFN6O |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 8-chloro-6-fluoro-7-(5-methyl-1H-indazol-4-yl)-4-(4-prop-2-enoylpiperazin-1-yl)quinoline-3-carbonitrile |
| SMILES | C=CC(=O)N1CCN(c2c(C#N)cnc3c(Cl)c(-c4c(C)ccc5[nH]ncc45)c(F)cc23)CC1 |
| InChI | InChI=1S/C25H20ClFN6O/c1-3-20(34)32-6-8-33(9-7-32)25-15(11-28)12-29-24-16(25)10-18(27)22(23(24)26)21-14(2)4-5-19-17(21)13-30-31-19/h3-5,10,12-13H,1,6-9H2,2H3,(H,30,31) |
| InChIKey | QRWZMFAPMFPWJE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|