About 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid
3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid (PubChem CID 155209014) has the molecular formula C16H29NO3S
and a molecular weight of 315.48 g/mol. Its IUPAC name is 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid.
Molecular Properties
| Compound Name | 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid |
| PubChem CID | 155209014 |
| Molecular Formula | C16H29NO3S |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid |
| SMILES | CC(CS(=O)(=O)O)C(N)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C16H29NO3S/c1-11(7-21(18,19)20)13(17)16-6-12-4-14(2,9-16)8-15(3,5-12)10-16/h11-13H,4-10,17H2,1-3H3,(H,18,19,20) |
| InChIKey | RPQSQLHSRNIPHJ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid?
The IUPAC name of 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid (CID 155209014) is 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid.
What is the SMILES notation for 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid?
The canonical SMILES for 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid is CC(CS(=O)(=O)O)C(N)C12CC3CC(C)(CC(C)(C3)C1)C2.
What is the InChIKey of 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid?
The InChIKey is RPQSQLHSRNIPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3S/c1-11(7-21(18,19)20)13(17)16-6-12-4-14(2,9-16)8-15(3,5-12)10-16/h11-13H,4-10,17H2,1-3H3,(H,18,19,20).
What are the key properties of 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid?
3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid has a molecular weight of 315.48 g/mol, XLogP of 2.83, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(3,5-dimethyl-1-adamantyl)-2-methylpropane-1-sulfonic acid is sourced from PubChem (CID 155209014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).