C16H17N5O2 — CID 155209218
5-[6-amino-5-(aminomethyl)-3-(5-methylfuran-3-yl)pyrazin-2-yl]-1-methylpyridin-2-one (PubChem CID 155209218) has the molecular formula C16H17N5O2 and a molecular weight of 311.35 g/mol. Its IUPAC name is 5-[6-amino-5-(aminomethyl)-3-(5-methylfuran-3-yl)pyrazin-2-yl]-1-methylpyridin-2-one.
| Compound Name | 5-[6-amino-5-(aminomethyl)-3-(5-methylfuran-3-yl)pyrazin-2-yl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 155209218 |
| Molecular Formula | C16H17N5O2 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 5-[6-amino-5-(aminomethyl)-3-(5-methylfuran-3-yl)pyrazin-2-yl]-1-methylpyridin-2-one |
| SMILES | Cc1cc(-c2nc(CN)c(N)nc2-c2ccc(=O)n(C)c2)co1 |
| InChI | InChI=1S/C16H17N5O2/c1-9-5-11(8-23-9)15-14(20-16(18)12(6-17)19-15)10-3-4-13(22)21(2)7-10/h3-5,7-8H,6,17H2,1-2H3,(H2,18,20) |
| InChIKey | GKCDDFTWHUCSLB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |