C20H26O6 — CID 15520990
(E,6Z)-2-(4-methylpent-3-enyl)-6-[3-(5-oxo-2H-furan-4-yl)propylidene]hept-2-enedioic acid (PubChem CID 15520990) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (E,6Z)-2-(4-methylpent-3-enyl)-6-[3-(5-oxo-2H-furan-4-yl)propylidene]hept-2-enedioic acid.
| Compound Name | (E,6Z)-2-(4-methylpent-3-enyl)-6-[3-(5-oxo-2H-furan-4-yl)propylidene]hept-2-enedioic acid |
|---|---|
| PubChem CID | 15520990 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (E,6Z)-2-(4-methylpent-3-enyl)-6-[3-(5-oxo-2H-furan-4-yl)propylidene]hept-2-enedioic acid |
| SMILES | CC(C)=CCC/C(=C\CC/C(=C/CCC1=CCOC1=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C20H26O6/c1-14(2)6-3-7-15(18(21)22)8-4-9-16(19(23)24)10-5-11-17-12-13-26-20(17)25/h6,8,10,12H,3-5,7,9,11,13H2,1-2H3,(H,21,22)(H,23,24)/b15-8+,16-10- |
| InChIKey | PNULYALODGNHHJ-BAEUGAPFSA-N |
| XLogP | 3.80 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|