C38H71N7O7 — CID 155210037
(3R,6S,9S,12S,15S,18R,19R)-6-(4-aminobutoxymethyl)-9-(aminomethyl)-12-cycloheptyl-19-hexyl-3,16,18-trimethyl-15-propyl-1-oxa-4,7,10,13,16-pentazacyclononadecane-5,8,11,14,17-pentone (PubChem CID 155210037) has the molecular formula C38H71N7O7 and a molecular weight of 738.03 g/mol. Its IUPAC name is (3R,6S,9S,12S,15S,18R,19R)-6-(4-aminobutoxymethyl)-9-(aminomethyl)-12-cycloheptyl-19-hexyl-3,16,18-trimethyl-15-propyl-1-oxa-4,7,10,13,16-pentazacyclononadecane-5,8,11,14,17-pentone.
| Compound Name | (3R,6S,9S,12S,15S,18R,19R)-6-(4-aminobutoxymethyl)-9-(aminomethyl)-12-cycloheptyl-19-hexyl-3,16,18-trimethyl-15-propyl-1-oxa-4,7,10,13,16-pentazacyclononadecane-5,8,11,14,17-pentone |
|---|---|
| PubChem CID | 155210037 |
| Molecular Formula | C38H71N7O7 |
| Molecular Weight | 738.03 g/mol |
| Exact Mass | 737.54 |
| IUPAC Name | (3R,6S,9S,12S,15S,18R,19R)-6-(4-aminobutoxymethyl)-9-(aminomethyl)-12-cycloheptyl-19-hexyl-3,16,18-trimethyl-15-propyl-1-oxa-4,7,10,13,16-pentazacyclononadecane-5,8,11,14,17-pentone |
| SMILES | CCCCCC[C@H]1OC[C@@H](C)NC(=O)[C@H](COCCCCN)NC(=O)[C@H](CN)NC(=O)[C@H](C2CCCCCC2)NC(=O)[C@H](CCC)N(C)C(=O)[C@@H]1C |
| InChI | InChI=1S/C38H71N7O7/c1-6-8-9-14-20-32-27(4)38(50)45(5)31(17-7-2)36(48)44-33(28-18-12-10-11-13-19-28)37(49)42-29(23-40)34(46)43-30(25-51-22-16-15-21-39)35(47)41-26(3)24-52-32/h26-33H,6-25,39-40H2,1-5H3,(H,41,47)(H,42,49)(H,43,46)(H,44,48)/t26-,27-,29+,30+,31+,32-,33+/m1/s1 |
| InChIKey | INALGPNNIDMQNR-VGUVRBKFSA-N |
| XLogP | 2.26 |
| TPSA | 207.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.03 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|