About 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine
1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine (PubChem CID 15521042) has the molecular formula C14H17Cl2NO
and a molecular weight of 286.20 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine |
| PubChem CID | 15521042 |
| Molecular Formula | C14H17Cl2NO |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine |
| SMILES | Clc1ccc(OCCCN2CC=CCC2)c(Cl)c1 |
| InChI | InChI=1S/C14H17Cl2NO/c15-12-5-6-14(13(16)11-12)18-10-4-9-17-7-2-1-3-8-17/h1-2,5-6,11H,3-4,7-10H2 |
| InChIKey | BDBKTQWAORGGJI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine?
The IUPAC name of 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine (CID 15521042) is 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine?
The canonical SMILES for 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine is Clc1ccc(OCCCN2CC=CCC2)c(Cl)c1.
What is the InChIKey of 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine?
The InChIKey is BDBKTQWAORGGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2NO/c15-12-5-6-14(13(16)11-12)18-10-4-9-17-7-2-1-3-8-17/h1-2,5-6,11H,3-4,7-10H2.
What are the key properties of 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine?
1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine has a molecular weight of 286.20 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(2,4-dichlorophenoxy)propyl]-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 15521042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).