C26H21F3N6O3S — CID 155210446
5-[5-amino-2-[(2,6-difluorophenyl)methyl]-7-(4-fluorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1-(1,1-dihydroxythietan-3-yl)pyridin-2-one (PubChem CID 155210446) has the molecular formula C26H21F3N6O3S and a molecular weight of 554.55 g/mol. Its IUPAC name is 5-[5-amino-2-[(2,6-difluorophenyl)methyl]-7-(4-fluorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1-(1,1-dihydroxythietan-3-yl)pyridin-2-one.
| Compound Name | 5-[5-amino-2-[(2,6-difluorophenyl)methyl]-7-(4-fluorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1-(1,1-dihydroxythietan-3-yl)pyridin-2-one |
|---|---|
| PubChem CID | 155210446 |
| Molecular Formula | C26H21F3N6O3S |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | 5-[5-amino-2-[(2,6-difluorophenyl)methyl]-7-(4-fluorophenyl)-[1,2,4]triazolo[1,5-c]pyrimidin-8-yl]-1-(1,1-dihydroxythietan-3-yl)pyridin-2-one |
| SMILES | Nc1nc(-c2ccc(F)cc2)c(-c2ccc(=O)n(C3CS(O)(O)C3)c2)c2nc(Cc3c(F)cccc3F)nn12 |
| InChI | InChI=1S/C26H21F3N6O3S/c27-16-7-4-14(5-8-16)24-23(15-6-9-22(36)34(11-15)17-12-39(37,38)13-17)25-31-21(33-35(25)26(30)32-24)10-18-19(28)2-1-3-20(18)29/h1-9,11,17,37-38H,10,12-13H2,(H2,30,32) |
| InChIKey | VGJKQZKWVZYYBD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 131.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |