C43H42N2O14S — CID 155210665
[1-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dibenzoyloxypropyl)-4-methoxyoxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-yl] 3,5-dinitrobenzoate (PubChem CID 155210665) has the molecular formula C43H42N2O14S and a molecular weight of 842.88 g/mol. Its IUPAC name is [1-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dibenzoyloxypropyl)-4-methoxyoxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-yl] 3,5-dinitrobenzoate.
| Compound Name | [1-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dibenzoyloxypropyl)-4-methoxyoxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-yl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 155210665 |
| Molecular Formula | C43H42N2O14S |
| Molecular Weight | 842.88 g/mol |
| Exact Mass | 842.24 |
| IUPAC Name | [1-[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dibenzoyloxypropyl)-4-methoxyoxolan-2-yl]-4-methyl-3-methylidenepent-4-en-2-yl] 3,5-dinitrobenzoate |
| SMILES | C=C(C)C(=C)C(C[C@@H]1O[C@H](CC(COC(=O)c2ccccc2)OC(=O)c2ccccc2)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C43H42N2O14S/c1-27(2)28(3)37(59-43(48)31-20-32(44(49)50)22-33(21-31)45(51)52)24-38-36(26-60(53,54)35-18-12-7-13-19-35)40(55-4)39(58-38)23-34(57-42(47)30-16-10-6-11-17-30)25-56-41(46)29-14-8-5-9-15-29/h5-22,34,36-40H,1,3,23-26H2,2,4H3/t34?,36-,37?,38-,39+,40+/m0/s1 |
| InChIKey | JBBUNKMUKYDVQG-UCRLUGDYSA-N |
| XLogP | 6.90 |
| TPSA | 217.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 842.88 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|