About 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one
3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one (PubChem CID 15521081) has the molecular formula C17H20O5S
and a molecular weight of 336.41 g/mol. Its IUPAC name is 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one.
Molecular Properties
| Compound Name | 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one |
| PubChem CID | 15521081 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one |
| SMILES | CC1(C)OC(=O)C(OC2CCC2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C17H20O5S/c1-17(2)14(11-7-9-13(10-8-11)23(3,19)20)15(16(18)22-17)21-12-5-4-6-12/h7-10,12H,4-6H2,1-3H3 |
| InChIKey | FEOYFLSIRFBESM-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The IUPAC name of 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one (CID 15521081) is 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one.
What is the SMILES notation for 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The canonical SMILES for 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one is CC1(C)OC(=O)C(OC2CCC2)=C1c1ccc(S(C)(=O)=O)cc1.
What is the InChIKey of 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
The InChIKey is FEOYFLSIRFBESM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O5S/c1-17(2)14(11-7-9-13(10-8-11)23(3,19)20)15(16(18)22-17)21-12-5-4-6-12/h7-10,12H,4-6H2,1-3H3.
What are the key properties of 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one?
3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one has a molecular weight of 336.41 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyloxy-5,5-dimethyl-4-(4-methylsulfonylphenyl)furan-2-one is sourced from PubChem (CID 15521081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).