About 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine
7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 155211044) has the molecular formula C13H13ClF3N5
and a molecular weight of 331.73 g/mol. Its IUPAC name is 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine.
Molecular Properties
| Compound Name | 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine |
| PubChem CID | 155211044 |
| Molecular Formula | C13H13ClF3N5 |
| Molecular Weight | 331.73 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(Cl)ncc2c(N3CCNC(CC(F)F)C3)ncnc12 |
| InChI | InChI=1S/C13H13ClF3N5/c14-12-10(17)11-8(4-19-12)13(21-6-20-11)22-2-1-18-7(5-22)3-9(15)16/h4,6-7,9,18H,1-3,5H2 |
| InChIKey | ICUATGJFERGIGB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.73 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine?
The IUPAC name of 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine (CID 155211044) is 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine.
What is the SMILES notation for 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine?
The canonical SMILES for 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine is Fc1c(Cl)ncc2c(N3CCNC(CC(F)F)C3)ncnc12.
What is the InChIKey of 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine?
The InChIKey is ICUATGJFERGIGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClF3N5/c14-12-10(17)11-8(4-19-12)13(21-6-20-11)22-2-1-18-7(5-22)3-9(15)16/h4,6-7,9,18H,1-3,5H2.
What are the key properties of 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine?
7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine has a molecular weight of 331.73 g/mol, XLogP of 2.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-[3-(2,2-difluoroethyl)piperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine is sourced from PubChem (CID 155211044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).