C17H19Cl2F2N5O2 — CID 155211089
tert-butyl 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-(fluoromethyl)piperazine-1-carboxylate (PubChem CID 155211089) has the molecular formula C17H19Cl2F2N5O2 and a molecular weight of 434.27 g/mol. Its IUPAC name is tert-butyl 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-(fluoromethyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-(fluoromethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155211089 |
| Molecular Formula | C17H19Cl2F2N5O2 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | tert-butyl 4-(2,7-dichloro-8-fluoropyrido[4,3-d]pyrimidin-4-yl)-2-(fluoromethyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2nc(Cl)nc3c(F)c(Cl)ncc23)CC1CF |
| InChI | InChI=1S/C17H19Cl2F2N5O2/c1-17(2,3)28-16(27)26-5-4-25(8-9(26)6-20)14-10-7-22-13(18)11(21)12(10)23-15(19)24-14/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | VAMNIOVAALLAMM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|