C13H15ClFN5 — CID 155211239
7-chloro-4-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine (PubChem CID 155211239) has the molecular formula C13H15ClFN5 and a molecular weight of 295.75 g/mol. Its IUPAC name is 7-chloro-4-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine.
| Compound Name | 7-chloro-4-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 155211239 |
| Molecular Formula | C13H15ClFN5 |
| Molecular Weight | 295.75 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 7-chloro-4-[(2S,5R)-2,5-dimethylpiperazin-1-yl]-8-fluoropyrido[4,3-d]pyrimidine |
| SMILES | C[C@@H]1CN(c2ncnc3c(F)c(Cl)ncc23)[C@@H](C)CN1 |
| InChI | InChI=1S/C13H15ClFN5/c1-7-5-20(8(2)3-16-7)13-9-4-17-12(14)10(15)11(9)18-6-19-13/h4,6-8,16H,3,5H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | VZZQFWVZBAHZSM-SFYZADRCSA-N |
| XLogP | 2.00 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.75 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|