About [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid
[(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid (PubChem CID 155211571) has the molecular formula C13H20F3NO5
and a molecular weight of 327.30 g/mol. Its IUPAC name is [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid.
Molecular Properties
| Compound Name | [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid |
| PubChem CID | 155211571 |
| Molecular Formula | C13H20F3NO5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CC[C@@H](COCC2CC(OC(F)(F)F)C2)OC1 |
| InChI | InChI=1S/C13H20F3NO5/c14-13(15,16)22-11-3-8(4-11)5-20-7-10-2-1-9(6-21-10)17-12(18)19/h8-11,17H,1-7H2,(H,18,19)/t8?,9-,10+,11?/m1/s1 |
| InChIKey | PUWIZMOFRSRWII-WIFZPCQCSA-N |
| XLogP | 2.13 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid?
The IUPAC name of [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid (CID 155211571) is [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid.
What is the SMILES notation for [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid?
The canonical SMILES for [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid is O=C(O)N[C@@H]1CC[C@@H](COCC2CC(OC(F)(F)F)C2)OC1.
What is the InChIKey of [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid?
The InChIKey is PUWIZMOFRSRWII-WIFZPCQCSA-N. The full InChI is InChI=1S/C13H20F3NO5/c14-13(15,16)22-11-3-8(4-11)5-20-7-10-2-1-9(6-21-10)17-12(18)19/h8-11,17H,1-7H2,(H,18,19)/t8?,9-,10+,11?/m1/s1.
What are the key properties of [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid?
[(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid has a molecular weight of 327.30 g/mol, XLogP of 2.13, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6S)-6-[[3-(trifluoromethoxy)cyclobutyl]methoxymethyl]oxan-3-yl]carbamic acid is sourced from PubChem (CID 155211571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).