About (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate
(2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate (PubChem CID 155211639) has the molecular formula C8H14O5
and a molecular weight of 190.19 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate |
| PubChem CID | 155211639 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate |
| SMILES | CC1(C)OCC(COC(=O)O)CO1 |
| InChI | InChI=1S/C8H14O5/c1-8(2)12-4-6(5-13-8)3-11-7(9)10/h6H,3-5H2,1-2H3,(H,9,10) |
| InChIKey | KOXNQVAJANBHNG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate?
The IUPAC name of (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate (CID 155211639) is (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate?
The canonical SMILES for (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate is CC1(C)OCC(COC(=O)O)CO1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate?
The InChIKey is KOXNQVAJANBHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O5/c1-8(2)12-4-6(5-13-8)3-11-7(9)10/h6H,3-5H2,1-2H3,(H,9,10).
What are the key properties of (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate?
(2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate has a molecular weight of 190.19 g/mol, XLogP of 1.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxan-5-yl)methyl hydrogen carbonate is sourced from PubChem (CID 155211639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).