About formamido 2-cyclopentylacetate
formamido 2-cyclopentylacetate (PubChem CID 155211748) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is formamido 2-cyclopentylacetate.
Molecular Properties
| Compound Name | formamido 2-cyclopentylacetate |
| PubChem CID | 155211748 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | formamido 2-cyclopentylacetate |
| SMILES | O=CNOC(=O)CC1CCCC1 |
| InChI | InChI=1S/C8H13NO3/c10-6-9-12-8(11)5-7-3-1-2-4-7/h6-7H,1-5H2,(H,9,10) |
| InChIKey | STFPWLDYXNNPKA-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formamido 2-cyclopentylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamido 2-cyclopentylacetate?
The IUPAC name of formamido 2-cyclopentylacetate (CID 155211748) is formamido 2-cyclopentylacetate.
What is the SMILES notation for formamido 2-cyclopentylacetate?
The canonical SMILES for formamido 2-cyclopentylacetate is O=CNOC(=O)CC1CCCC1.
What is the InChIKey of formamido 2-cyclopentylacetate?
The InChIKey is STFPWLDYXNNPKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c10-6-9-12-8(11)5-7-3-1-2-4-7/h6-7H,1-5H2,(H,9,10).
What are the key properties of formamido 2-cyclopentylacetate?
formamido 2-cyclopentylacetate has a molecular weight of 171.20 g/mol, XLogP of 0.77, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formamido 2-cyclopentylacetate is sourced from PubChem (CID 155211748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).