C25H38O5Si — CID 15521265
(2R,3S,4S,6S)-3-ethenyl-3-methyl-2-(oxan-2-yloxymethyl)-4-phenylmethoxy-6-trimethylsilyloxycyclohexan-1-one (PubChem CID 15521265) has the molecular formula C25H38O5Si and a molecular weight of 446.66 g/mol. Its IUPAC name is (2R,3S,4S,6S)-3-ethenyl-3-methyl-2-(oxan-2-yloxymethyl)-4-phenylmethoxy-6-trimethylsilyloxycyclohexan-1-one.
| Compound Name | (2R,3S,4S,6S)-3-ethenyl-3-methyl-2-(oxan-2-yloxymethyl)-4-phenylmethoxy-6-trimethylsilyloxycyclohexan-1-one |
|---|---|
| PubChem CID | 15521265 |
| Molecular Formula | C25H38O5Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (2R,3S,4S,6S)-3-ethenyl-3-methyl-2-(oxan-2-yloxymethyl)-4-phenylmethoxy-6-trimethylsilyloxycyclohexan-1-one |
| SMILES | C=C[C@]1(C)[C@@H](OCc2ccccc2)C[C@H](O[Si](C)(C)C)C(=O)[C@H]1COC1CCCCO1 |
| InChI | InChI=1S/C25H38O5Si/c1-6-25(2)20(18-29-23-14-10-11-15-27-23)24(26)21(30-31(3,4)5)16-22(25)28-17-19-12-8-7-9-13-19/h6-9,12-13,20-23H,1,10-11,14-18H2,2-5H3/t20-,21+,22+,23?,25+/m1/s1 |
| InChIKey | FEXKUHMDBZBFJX-KEJNYHSHSA-N |
| XLogP | 5.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|