About 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone
1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone (PubChem CID 155212939) has the molecular formula C20H21F2NO3S
and a molecular weight of 393.46 g/mol. Its IUPAC name is 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone |
| PubChem CID | 155212939 |
| Molecular Formula | C20H21F2NO3S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)CC1 |
| InChI | InChI=1S/C20H21F2NO3S/c1-14(24)23-10-8-15(9-11-23)13-27(25,26)18-5-2-16(3-6-18)19-7-4-17(21)12-20(19)22/h2-7,12,15H,8-11,13H2,1H3 |
| InChIKey | RBJDVDFBUNAIIS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone?
The IUPAC name of 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone (CID 155212939) is 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone?
The canonical SMILES for 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone is CC(=O)N1CCC(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)CC1.
What is the InChIKey of 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone?
The InChIKey is RBJDVDFBUNAIIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21F2NO3S/c1-14(24)23-10-8-15(9-11-23)13-27(25,26)18-5-2-16(3-6-18)19-7-4-17(21)12-20(19)22/h2-7,12,15H,8-11,13H2,1H3.
What are the key properties of 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone?
1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone has a molecular weight of 393.46 g/mol, XLogP of 3.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]piperidin-1-yl]ethanone is sourced from PubChem (CID 155212939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).