About [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate
[(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate (PubChem CID 155213713) has the molecular formula C17H15FN2O3S
and a molecular weight of 346.38 g/mol. Its IUPAC name is [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate.
Molecular Properties
| Compound Name | [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate |
| PubChem CID | 155213713 |
| Molecular Formula | C17H15FN2O3S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate |
| SMILES | CC[C@@H](OC(C)=O)c1csc(C(=O)c2c[nH]c3cc(F)ccc23)n1 |
| InChI | InChI=1S/C17H15FN2O3S/c1-3-15(23-9(2)21)14-8-24-17(20-14)16(22)12-7-19-13-6-10(18)4-5-11(12)13/h4-8,15,19H,3H2,1-2H3/t15-/m1/s1 |
| InChIKey | JYXGAMSEUMPVAL-OAHLLOKOSA-N |
| XLogP | 4.01 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate?
The IUPAC name of [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate (CID 155213713) is [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate.
What is the SMILES notation for [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate?
The canonical SMILES for [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate is CC[C@@H](OC(C)=O)c1csc(C(=O)c2c[nH]c3cc(F)ccc23)n1.
What is the InChIKey of [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate?
The InChIKey is JYXGAMSEUMPVAL-OAHLLOKOSA-N. The full InChI is InChI=1S/C17H15FN2O3S/c1-3-15(23-9(2)21)14-8-24-17(20-14)16(22)12-7-19-13-6-10(18)4-5-11(12)13/h4-8,15,19H,3H2,1-2H3/t15-/m1/s1.
What are the key properties of [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate?
[(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate has a molecular weight of 346.38 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl] acetate is sourced from PubChem (CID 155213713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).