About 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate
1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate (PubChem CID 155213805) has the molecular formula C19H18BrFN2O3S
and a molecular weight of 453.33 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate.
Molecular Properties
| Compound Name | 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate |
| PubChem CID | 155213805 |
| Molecular Formula | C19H18BrFN2O3S |
| Molecular Weight | 453.33 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate |
| SMILES | CCC(OC(=O)CCCBr)c1csc(C(=O)c2c[nH]c3cc(F)ccc23)n1 |
| InChI | InChI=1S/C19H18BrFN2O3S/c1-2-16(26-17(24)4-3-7-20)15-10-27-19(23-15)18(25)13-9-22-14-8-11(21)5-6-12(13)14/h5-6,8-10,16,22H,2-4,7H2,1H3 |
| InChIKey | XJQKKDOJSBJKET-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.33 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate?
The IUPAC name of 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate (CID 155213805) is 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate.
What is the SMILES notation for 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate?
The canonical SMILES for 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate is CCC(OC(=O)CCCBr)c1csc(C(=O)c2c[nH]c3cc(F)ccc23)n1.
What is the InChIKey of 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate?
The InChIKey is XJQKKDOJSBJKET-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18BrFN2O3S/c1-2-16(26-17(24)4-3-7-20)15-10-27-19(23-15)18(25)13-9-22-14-8-11(21)5-6-12(13)14/h5-6,8-10,16,22H,2-4,7H2,1H3.
What are the key properties of 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate?
1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate has a molecular weight of 453.33 g/mol, XLogP of 5.16, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 4-bromobutanoate is sourced from PubChem (CID 155213805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).