About 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate
1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate (PubChem CID 155213853) has the molecular formula C21H22FN3O4S
and a molecular weight of 431.49 g/mol. Its IUPAC name is 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate.
Molecular Properties
| Compound Name | 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate |
| PubChem CID | 155213853 |
| Molecular Formula | C21H22FN3O4S |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate |
| SMILES | CCC(OC(=O)CN1CCOCC1)c1csc(C(=O)c2c[nH]c3cc(F)ccc23)n1 |
| InChI | InChI=1S/C21H22FN3O4S/c1-2-18(29-19(26)11-25-5-7-28-8-6-25)17-12-30-21(24-17)20(27)15-10-23-16-9-13(22)3-4-14(15)16/h3-4,9-10,12,18,23H,2,5-8,11H2,1H3 |
| InChIKey | YYLULFNIRXBECC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate?
The IUPAC name of 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate (CID 155213853) is 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate.
What is the SMILES notation for 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate?
The canonical SMILES for 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate is CCC(OC(=O)CN1CCOCC1)c1csc(C(=O)c2c[nH]c3cc(F)ccc23)n1.
What is the InChIKey of 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate?
The InChIKey is YYLULFNIRXBECC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FN3O4S/c1-2-18(29-19(26)11-25-5-7-28-8-6-25)17-12-30-21(24-17)20(27)15-10-23-16-9-13(22)3-4-14(15)16/h3-4,9-10,12,18,23H,2,5-8,11H2,1H3.
What are the key properties of 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate?
1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate has a molecular weight of 431.49 g/mol, XLogP of 3.32, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(6-fluoro-1H-indole-3-carbonyl)-1,3-thiazol-4-yl]propyl 2-morpholin-4-ylacetate is sourced from PubChem (CID 155213853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).