C24H25F3N2O2 — CID 155213855
N-[(2R)-4-(ethylamino)butan-2-yl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide (PubChem CID 155213855) has the molecular formula C24H25F3N2O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[(2R)-4-(ethylamino)butan-2-yl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide.
| Compound Name | N-[(2R)-4-(ethylamino)butan-2-yl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 155213855 |
| Molecular Formula | C24H25F3N2O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-[(2R)-4-(ethylamino)butan-2-yl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
| SMILES | CCNCC[C@@H](C)NC(=O)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1 |
| InChI | InChI=1S/C24H25F3N2O2/c1-3-28-14-13-16(2)29-23(30)18-7-12-21-17(15-18)5-4-6-22(21)31-20-10-8-19(9-11-20)24(25,26)27/h4-12,15-16,28H,3,13-14H2,1-2H3,(H,29,30)/t16-/m1/s1 |
| InChIKey | DPTCRRAJVXNZCM-MRXNPFEDSA-N |
| XLogP | 5.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|