C25H25F3N2O2 — CID 155214284
N-[(1R)-1-piperidin-4-ylethyl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide (PubChem CID 155214284) has the molecular formula C25H25F3N2O2 and a molecular weight of 442.48 g/mol. Its IUPAC name is N-[(1R)-1-piperidin-4-ylethyl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide.
| Compound Name | N-[(1R)-1-piperidin-4-ylethyl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 155214284 |
| Molecular Formula | C25H25F3N2O2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[(1R)-1-piperidin-4-ylethyl]-5-[4-(trifluoromethyl)phenoxy]naphthalene-2-carboxamide |
| SMILES | C[C@@H](NC(=O)c1ccc2c(Oc3ccc(C(F)(F)F)cc3)cccc2c1)C1CCNCC1 |
| InChI | InChI=1S/C25H25F3N2O2/c1-16(17-11-13-29-14-12-17)30-24(31)19-5-10-22-18(15-19)3-2-4-23(22)32-21-8-6-20(7-9-21)25(26,27)28/h2-10,15-17,29H,11-14H2,1H3,(H,30,31)/t16-/m1/s1 |
| InChIKey | JWJTVVKFQOXMDT-MRXNPFEDSA-N |
| XLogP | 5.77 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |