C16H8F5NO3 — CID 155214328
5,5,6,6-tetrafluoro-10-[(5-fluoro-3-pyridinyl)oxy]-4-hydroxytricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one (PubChem CID 155214328) has the molecular formula C16H8F5NO3 and a molecular weight of 357.23 g/mol. Its IUPAC name is 5,5,6,6-tetrafluoro-10-[(5-fluoro-3-pyridinyl)oxy]-4-hydroxytricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one.
| Compound Name | 5,5,6,6-tetrafluoro-10-[(5-fluoro-3-pyridinyl)oxy]-4-hydroxytricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one |
|---|---|
| PubChem CID | 155214328 |
| Molecular Formula | C16H8F5NO3 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 5,5,6,6-tetrafluoro-10-[(5-fluoro-3-pyridinyl)oxy]-4-hydroxytricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one |
| SMILES | O=C1CC2(O)c3c(ccc(Oc4cncc(F)c4)c31)C(F)(F)C2(F)F |
| InChI | InChI=1S/C16H8F5NO3/c17-7-3-8(6-22-5-7)25-11-2-1-9-13-12(11)10(23)4-14(13,24)16(20,21)15(9,18)19/h1-3,5-6,24H,4H2 |
| InChIKey | LJUPMXCSMLGVTG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|