C11H3F7O2 — CID 155214336
3,3,5,5,6,6,10-heptafluoro-4-hydroxytricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one (PubChem CID 155214336) has the molecular formula C11H3F7O2 and a molecular weight of 300.13 g/mol. Its IUPAC name is 3,3,5,5,6,6,10-heptafluoro-4-hydroxytricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one.
| Compound Name | 3,3,5,5,6,6,10-heptafluoro-4-hydroxytricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one |
|---|---|
| PubChem CID | 155214336 |
| Molecular Formula | C11H3F7O2 |
| Molecular Weight | 300.13 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 3,3,5,5,6,6,10-heptafluoro-4-hydroxytricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trien-2-one |
| SMILES | O=C1c2c(F)ccc3c2C(O)(C1(F)F)C(F)(F)C3(F)F |
| InChI | InChI=1S/C11H3F7O2/c12-4-2-1-3-6-5(4)7(19)10(15,16)8(6,20)11(17,18)9(3,13)14/h1-2,20H |
| InChIKey | CDECQPJQBYLCBH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|