About 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione
2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione (PubChem CID 155214717) has the molecular formula C11H15N5O2
and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione.
Molecular Properties
| Compound Name | 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione |
| PubChem CID | 155214717 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione |
| SMILES | Nc1nc2c([nH]c(=O)n2C2CCCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H15N5O2/c12-10-14-8-7(9(17)15-10)13-11(18)16(8)6-4-2-1-3-5-6/h6H,1-5H2,(H,13,18)(H3,12,14,15,17) |
| InChIKey | UYGJAPZYUXAMMO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione?
The IUPAC name of 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione (CID 155214717) is 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione.
What is the SMILES notation for 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione?
The canonical SMILES for 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione is Nc1nc2c([nH]c(=O)n2C2CCCCC2)c(=O)[nH]1.
What is the InChIKey of 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione?
The InChIKey is UYGJAPZYUXAMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O2/c12-10-14-8-7(9(17)15-10)13-11(18)16(8)6-4-2-1-3-5-6/h6H,1-5H2,(H,13,18)(H3,12,14,15,17).
What are the key properties of 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione?
2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione has a molecular weight of 249.27 g/mol, XLogP of 0.50, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-cyclohexyl-1,7-dihydropurine-6,8-dione is sourced from PubChem (CID 155214717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).