About 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione
2-amino-9-pentyl-1,7-dihydropurine-6,8-dione (PubChem CID 155214720) has the molecular formula C10H15N5O2
and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione.
Molecular Properties
| Compound Name | 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione |
| PubChem CID | 155214720 |
| Molecular Formula | C10H15N5O2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione |
| SMILES | CCCCCn1c(=O)[nH]c2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H15N5O2/c1-2-3-4-5-15-7-6(12-10(15)17)8(16)14-9(11)13-7/h2-5H2,1H3,(H,12,17)(H3,11,13,14,16) |
| InChIKey | BEUSKPBXKNKVGR-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione?
The IUPAC name of 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione (CID 155214720) is 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione.
What is the SMILES notation for 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione?
The canonical SMILES for 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione is CCCCCn1c(=O)[nH]c2c(=O)[nH]c(N)nc21.
What is the InChIKey of 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione?
The InChIKey is BEUSKPBXKNKVGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O2/c1-2-3-4-5-15-7-6(12-10(15)17)8(16)14-9(11)13-7/h2-5H2,1H3,(H,12,17)(H3,11,13,14,16).
What are the key properties of 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione?
2-amino-9-pentyl-1,7-dihydropurine-6,8-dione has a molecular weight of 237.26 g/mol, XLogP of 0.19, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-9-pentyl-1,7-dihydropurine-6,8-dione is sourced from PubChem (CID 155214720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).