C21H45N3O — CID 155214987
N-[3-(4-tert-butylpiperazin-1-yl)butan-2-yl]-4-[(2-methylpropan-2-yl)oxy]pentan-2-amine (PubChem CID 155214987) has the molecular formula C21H45N3O and a molecular weight of 355.61 g/mol. Its IUPAC name is N-[3-(4-tert-butylpiperazin-1-yl)butan-2-yl]-4-[(2-methylpropan-2-yl)oxy]pentan-2-amine.
| Compound Name | N-[3-(4-tert-butylpiperazin-1-yl)butan-2-yl]-4-[(2-methylpropan-2-yl)oxy]pentan-2-amine |
|---|---|
| PubChem CID | 155214987 |
| Molecular Formula | C21H45N3O |
| Molecular Weight | 355.61 g/mol |
| Exact Mass | 355.36 |
| IUPAC Name | N-[3-(4-tert-butylpiperazin-1-yl)butan-2-yl]-4-[(2-methylpropan-2-yl)oxy]pentan-2-amine |
| SMILES | CC(CC(C)OC(C)(C)C)NC(C)C(C)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H45N3O/c1-16(15-17(2)25-21(8,9)10)22-18(3)19(4)23-11-13-24(14-12-23)20(5,6)7/h16-19,22H,11-15H2,1-10H3 |
| InChIKey | HMGURNGYTOUJEY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.61 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |